C11H21N5OS — CID 83082665
[1-(azepan-1-yl)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082665) has the molecular formula C11H21N5OS and a molecular weight of 271.39 g/mol. Its IUPAC name is [1-(azepan-1-yl)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082665 |
| Molecular Formula | C11H21N5OS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SC(C)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C11H21N5OS/c1-8(18-11(14)15-10(12)13)9(17)16-6-4-2-3-5-7-16/h8H,2-7H2,1H3,(H5,12,13,14,15) |
| InChIKey | RRCFFKXHOIHTDH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|