About 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate
3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083282) has the molecular formula C9H19N5S
and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 83083282 |
| Molecular Formula | C9H19N5S |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCCCN1CCCC1 |
| InChI | InChI=1S/C9H19N5S/c10-8(11)13-9(12)15-7-3-6-14-4-1-2-5-14/h1-7H2,(H5,10,11,12,13) |
| InChIKey | BLTKBXNAVANCKF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate (CID 83083282) is 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate is [H]/N=C(/N=C(N)N)SCCCN1CCCC1.
What is the InChIKey of 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate?
The InChIKey is BLTKBXNAVANCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N5S/c10-8(11)13-9(12)15-7-3-6-14-4-1-2-5-14/h1-7H2,(H5,10,11,12,13).
What are the key properties of 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate?
3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate has a molecular weight of 229.35 g/mol, XLogP of 0.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylpropyl N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 83083282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).