About 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate
3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate (PubChem CID 77060950) has the molecular formula C8H18N4S
and a molecular weight of 202.33 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate |
| PubChem CID | 77060950 |
| Molecular Formula | C8H18N4S |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCCCN1CCCC1 |
| InChI | InChI=1S/C8H18N4S/c9-8(11-10)13-7-3-6-12-4-1-2-5-12/h1-7,10H2,(H2,9,11) |
| InChIKey | UVGZRKMXKSIGDQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate?
The IUPAC name of 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate (CID 77060950) is 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate.
What is the SMILES notation for 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate?
The canonical SMILES for 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate is NN=C(N)SCCCN1CCCC1.
What is the InChIKey of 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate?
The InChIKey is UVGZRKMXKSIGDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4S/c9-8(11-10)13-7-3-6-12-4-1-2-5-12/h1-7,10H2,(H2,9,11).
What are the key properties of 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate?
3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate has a molecular weight of 202.33 g/mol, XLogP of 0.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylpropyl N'-aminocarbamimidothioate is sourced from PubChem (CID 77060950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).