About 2-morpholin-4-ylethyl N'-aminocarbamimidothioate
2-morpholin-4-ylethyl N'-aminocarbamimidothioate (PubChem CID 77060850) has the molecular formula C7H16N4OS
and a molecular weight of 204.30 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl N'-aminocarbamimidothioate |
| PubChem CID | 77060850 |
| Molecular Formula | C7H16N4OS |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-morpholin-4-ylethyl N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCCN1CCOCC1 |
| InChI | InChI=1S/C7H16N4OS/c8-7(10-9)13-6-3-11-1-4-12-5-2-11/h1-6,9H2,(H2,8,10) |
| InChIKey | PKABRWGOFPQMLN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl N'-aminocarbamimidothioate?
The IUPAC name of 2-morpholin-4-ylethyl N'-aminocarbamimidothioate (CID 77060850) is 2-morpholin-4-ylethyl N'-aminocarbamimidothioate.
What is the SMILES notation for 2-morpholin-4-ylethyl N'-aminocarbamimidothioate?
The canonical SMILES for 2-morpholin-4-ylethyl N'-aminocarbamimidothioate is NN=C(N)SCCN1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylethyl N'-aminocarbamimidothioate?
The InChIKey is PKABRWGOFPQMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4OS/c8-7(10-9)13-6-3-11-1-4-12-5-2-11/h1-6,9H2,(H2,8,10).
What are the key properties of 2-morpholin-4-ylethyl N'-aminocarbamimidothioate?
2-morpholin-4-ylethyl N'-aminocarbamimidothioate has a molecular weight of 204.30 g/mol, XLogP of -0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl N'-aminocarbamimidothioate is sourced from PubChem (CID 77060850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).