About 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride
2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride (PubChem CID 54610602) has the molecular formula C9H19Cl2N3O
and a molecular weight of 256.18 g/mol. Its IUPAC name is 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride |
| PubChem CID | 54610602 |
| Molecular Formula | C9H19Cl2N3O |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride |
| SMILES | Cl.N/C(CCl)=N/CCCN1CCOCC1 |
| InChI | InChI=1S/C9H18ClN3O.ClH/c10-8-9(11)12-2-1-3-13-4-6-14-7-5-13;/h1-8H2,(H2,11,12);1H |
| InChIKey | SIZVPXRDBKAXNO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride?
The IUPAC name of 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride (CID 54610602) is 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride.
What is the SMILES notation for 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride?
The canonical SMILES for 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride is Cl.N/C(CCl)=N/CCCN1CCOCC1.
What is the InChIKey of 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride?
The InChIKey is SIZVPXRDBKAXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClN3O.ClH/c10-8-9(11)12-2-1-3-13-4-6-14-7-5-13;/h1-8H2,(H2,11,12);1H.
What are the key properties of 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride?
2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride has a molecular weight of 256.18 g/mol, XLogP of 0.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-(3-morpholin-4-ylpropyl)ethanimidamide;hydrochloride is sourced from PubChem (CID 54610602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).