About 3-morpholin-4-ylpropyl carbamimidothioate
3-morpholin-4-ylpropyl carbamimidothioate (PubChem CID 21163761) has the molecular formula C8H17N3OS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl carbamimidothioate.
Molecular Properties
| Compound Name | 3-morpholin-4-ylpropyl carbamimidothioate |
| PubChem CID | 21163761 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-morpholin-4-ylpropyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCN1CCOCC1 |
| InChI | InChI=1S/C8H17N3OS/c9-8(10)13-7-1-2-11-3-5-12-6-4-11/h1-7H2,(H3,9,10) |
| InChIKey | HQEVFNNGJWIGBB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-ylpropyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-ylpropyl carbamimidothioate?
The IUPAC name of 3-morpholin-4-ylpropyl carbamimidothioate (CID 21163761) is 3-morpholin-4-ylpropyl carbamimidothioate.
What is the SMILES notation for 3-morpholin-4-ylpropyl carbamimidothioate?
The canonical SMILES for 3-morpholin-4-ylpropyl carbamimidothioate is [H]/N=C(\N)SCCCN1CCOCC1.
What is the InChIKey of 3-morpholin-4-ylpropyl carbamimidothioate?
The InChIKey is HQEVFNNGJWIGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3OS/c9-8(10)13-7-1-2-11-3-5-12-6-4-11/h1-7H2,(H3,9,10).
What are the key properties of 3-morpholin-4-ylpropyl carbamimidothioate?
3-morpholin-4-ylpropyl carbamimidothioate has a molecular weight of 203.31 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-ylpropyl carbamimidothioate is sourced from PubChem (CID 21163761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).