About 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride
2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride (PubChem CID 21119542) has the molecular formula C7H17Cl2N3OS
and a molecular weight of 262.21 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride |
| PubChem CID | 21119542 |
| Molecular Formula | C7H17Cl2N3OS |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)OSCCN1CCCC1 |
| InChI | InChI=1S/C7H15N3OS.2ClH/c8-7(9)11-12-6-5-10-3-1-2-4-10;;/h1-6H2,(H3,8,9);2*1H |
| InChIKey | DYYJBZHHAGOEIK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride?
The IUPAC name of 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride (CID 21119542) is 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride.
What is the SMILES notation for 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride?
The canonical SMILES for 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride is Cl.Cl.[H]/N=C(\N)OSCCN1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride?
The InChIKey is DYYJBZHHAGOEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3OS.2ClH/c8-7(9)11-12-6-5-10-3-1-2-4-10;;/h1-6H2,(H3,8,9);2*1H.
What are the key properties of 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride?
2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride has a molecular weight of 262.21 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethylsulfanyl carbamimidate;dihydrochloride is sourced from PubChem (CID 21119542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).