C5H9F3N4S2 — CID 104891387
2-(trifluoromethylsulfanyl)ethyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 104891387) has the molecular formula C5H9F3N4S2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-(trifluoromethylsulfanyl)ethyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | 2-(trifluoromethylsulfanyl)ethyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 104891387 |
| Molecular Formula | C5H9F3N4S2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-(trifluoromethylsulfanyl)ethyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCCSC(F)(F)F |
| InChI | InChI=1S/C5H9F3N4S2/c6-5(7,8)14-2-1-13-4(11)12-3(9)10/h1-2H2,(H5,9,10,11,12) |
| InChIKey | RDYMXZYHHUTSBS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|