C7H14N4O2S — CID 83083454
methyl 4-[N-(diaminomethylidene)carbamimidoyl]sulfanylbutanoate (PubChem CID 83083454) has the molecular formula C7H14N4O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is methyl 4-[N-(diaminomethylidene)carbamimidoyl]sulfanylbutanoate.
| Compound Name | methyl 4-[N-(diaminomethylidene)carbamimidoyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 83083454 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | methyl 4-[N-(diaminomethylidene)carbamimidoyl]sulfanylbutanoate |
| SMILES | [H]/N=C(/N=C(N)N)SCCCC(=O)OC |
| InChI | InChI=1S/C7H14N4O2S/c1-13-5(12)3-2-4-14-7(10)11-6(8)9/h2-4H2,1H3,(H5,8,9,10,11) |
| InChIKey | GBTXTIRJWYGVNO-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|