C11H13Cl2N5OS — CID 83082313
[3-(2,5-dichloroanilino)-3-oxopropyl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082313) has the molecular formula C11H13Cl2N5OS and a molecular weight of 334.23 g/mol. Its IUPAC name is [3-(2,5-dichloroanilino)-3-oxopropyl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [3-(2,5-dichloroanilino)-3-oxopropyl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082313 |
| Molecular Formula | C11H13Cl2N5OS |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | [3-(2,5-dichloroanilino)-3-oxopropyl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2N5OS/c12-6-1-2-7(13)8(5-6)17-9(19)3-4-20-11(16)18-10(14)15/h1-2,5H,3-4H2,(H,17,19)(H5,14,15,16,18) |
| InChIKey | DVKUDPFMADKBEM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|