C10H12ClN5OS — CID 83083481
[2-(2-chloroanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083481) has the molecular formula C10H12ClN5OS and a molecular weight of 285.76 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083481 |
| Molecular Formula | C10H12ClN5OS |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C10H12ClN5OS/c11-6-3-1-2-4-7(6)15-8(17)5-18-10(14)16-9(12)13/h1-4H,5H2,(H,15,17)(H5,12,13,14,16) |
| InChIKey | WFTNTJNXVWFNBA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|