C14H8Cl5NOS — CID 2822568
N-(2-chlorophenyl)-2-(2,3,5,6-tetrachlorophenyl)sulfanylacetamide (PubChem CID 2822568) has the molecular formula C14H8Cl5NOS and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2,3,5,6-tetrachlorophenyl)sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-(2,3,5,6-tetrachlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 2822568 |
| Molecular Formula | C14H8Cl5NOS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 412.88 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2,3,5,6-tetrachlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1c(Cl)c(Cl)cc(Cl)c1Cl)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H8Cl5NOS/c15-7-3-1-2-4-10(7)20-11(21)6-22-14-12(18)8(16)5-9(17)13(14)19/h1-5H,6H2,(H,20,21) |
| InChIKey | UJQDTAOLZFGUAA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|