C8H13N3O3S — CID 163676337
methyl 4-[N-(1-aminoethylidene)carbamimidoyl]sulfanyl-3-oxobutanoate (PubChem CID 163676337) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is methyl 4-[N-(1-aminoethylidene)carbamimidoyl]sulfanyl-3-oxobutanoate.
| Compound Name | methyl 4-[N-(1-aminoethylidene)carbamimidoyl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 163676337 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | methyl 4-[N-(1-aminoethylidene)carbamimidoyl]sulfanyl-3-oxobutanoate |
| SMILES | [H]/N=C(\N=C(C)N)SCC(=O)CC(=O)OC |
| InChI | InChI=1S/C8H13N3O3S/c1-5(9)11-8(10)15-4-6(12)3-7(13)14-2/h3-4H2,1-2H3,(H3,9,10,11) |
| InChIKey | JHAGVPDTVKAFTB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|