C6H13N3O2 — CID 145275469
methyl 2-aminoacetate;propane-1,2-diimine (PubChem CID 145275469) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is methyl 2-aminoacetate;propane-1,2-diimine.
| Compound Name | methyl 2-aminoacetate;propane-1,2-diimine |
|---|---|
| PubChem CID | 145275469 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | methyl 2-aminoacetate;propane-1,2-diimine |
| SMILES | COC(=O)CN.[H]/N=C/C(C)=N/[H] |
| InChI | InChI=1S/C3H6N2.C3H7NO2/c1-3(5)2-4;1-6-3(5)2-4/h2,4-5H,1H3;2,4H2,1H3/b4-2+,5-3+; |
| InChIKey | XYNBNHPTECRGEH-BJMABRHOSA-N |
| XLogP | -0.21 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|