C7H15N3O2 — CID 28586640
2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide (PubChem CID 28586640) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide.
| Compound Name | 2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 28586640 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]acetamide |
| SMILES | CC(C)NC(=O)CNCC(N)=O |
| InChI | InChI=1S/C7H15N3O2/c1-5(2)10-7(12)4-9-3-6(8)11/h5,9H,3-4H2,1-2H3,(H2,8,11)(H,10,12) |
| InChIKey | QIKWPRIGHBBVKW-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |