C8H18N4O2 — CID 103239204
2-amino-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide (PubChem CID 103239204) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-amino-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide.
| Compound Name | 2-amino-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 103239204 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-amino-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide |
| SMILES | CC(C)NC(=O)CNCC(N)C(N)=O |
| InChI | InChI=1S/C8H18N4O2/c1-5(2)12-7(13)4-11-3-6(9)8(10)14/h5-6,11H,3-4,9H2,1-2H3,(H2,10,14)(H,12,13) |
| InChIKey | UNCTVIQEUPLXEE-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |