C7H17N3O — CID 103231048
2-amino-3-(2-methylpropylamino)propanamide (PubChem CID 103231048) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-amino-3-(2-methylpropylamino)propanamide.
| Compound Name | 2-amino-3-(2-methylpropylamino)propanamide |
|---|---|
| PubChem CID | 103231048 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 2-amino-3-(2-methylpropylamino)propanamide |
| SMILES | CC(C)CNCC(N)C(N)=O |
| InChI | InChI=1S/C7H17N3O/c1-5(2)3-10-4-6(8)7(9)11/h5-6,10H,3-4,8H2,1-2H3,(H2,9,11) |
| InChIKey | DQBQLBMLXVOVOO-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |