C9H20N4O2 — CID 103260238
2-amino-3-[[2-(tert-butylamino)-2-oxoethyl]amino]propanamide (PubChem CID 103260238) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-amino-3-[[2-(tert-butylamino)-2-oxoethyl]amino]propanamide.
| Compound Name | 2-amino-3-[[2-(tert-butylamino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 103260238 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-amino-3-[[2-(tert-butylamino)-2-oxoethyl]amino]propanamide |
| SMILES | CC(C)(C)NC(=O)CNCC(N)C(N)=O |
| InChI | InChI=1S/C9H20N4O2/c1-9(2,3)13-7(14)5-12-4-6(10)8(11)15/h6,12H,4-5,10H2,1-3H3,(H2,11,15)(H,13,14) |
| InChIKey | NBEYBQQIPNVOHE-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |