C7H17N3O3 — CID 103253317
2-amino-3-[(2-hydroxy-3-methoxypropyl)amino]propanamide (PubChem CID 103253317) has the molecular formula C7H17N3O3 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-3-[(2-hydroxy-3-methoxypropyl)amino]propanamide.
| Compound Name | 2-amino-3-[(2-hydroxy-3-methoxypropyl)amino]propanamide |
|---|---|
| PubChem CID | 103253317 |
| Molecular Formula | C7H17N3O3 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-amino-3-[(2-hydroxy-3-methoxypropyl)amino]propanamide |
| SMILES | COCC(O)CNCC(N)C(N)=O |
| InChI | InChI=1S/C7H17N3O3/c1-13-4-5(11)2-10-3-6(8)7(9)12/h5-6,10-11H,2-4,8H2,1H3,(H2,9,12) |
| InChIKey | FKEGKVMDIWGLEF-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |