C6H15N3O3 — CID 103256231
2-amino-3-(2,3-dihydroxypropylamino)propanamide (PubChem CID 103256231) has the molecular formula C6H15N3O3 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydroxypropylamino)propanamide.
| Compound Name | 2-amino-3-(2,3-dihydroxypropylamino)propanamide |
|---|---|
| PubChem CID | 103256231 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | 2-amino-3-(2,3-dihydroxypropylamino)propanamide |
| SMILES | NC(=O)C(N)CNCC(O)CO |
| InChI | InChI=1S/C6H15N3O3/c7-5(6(8)12)2-9-1-4(11)3-10/h4-5,9-11H,1-3,7H2,(H2,8,12) |
| InChIKey | YFKDZZFLZHUCBT-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |