C7H14N2O5 — CID 106178077
4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-3-hydroxybutanoic acid (PubChem CID 106178077) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-3-hydroxybutanoic acid.
| Compound Name | 4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 106178077 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-3-hydroxybutanoic acid |
| SMILES | NC(=O)C(O)CNCC(O)CC(=O)O |
| InChI | InChI=1S/C7H14N2O5/c8-7(14)5(11)3-9-2-4(10)1-6(12)13/h4-5,9-11H,1-3H2,(H2,8,14)(H,12,13) |
| InChIKey | IQWXPNGZDCCVTC-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |