C6H15N5O2 — CID 103262445
2-amino-3-[2-(carbamoylamino)ethylamino]propanamide (PubChem CID 103262445) has the molecular formula C6H15N5O2 and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-amino-3-[2-(carbamoylamino)ethylamino]propanamide.
| Compound Name | 2-amino-3-[2-(carbamoylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 103262445 |
| Molecular Formula | C6H15N5O2 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-amino-3-[2-(carbamoylamino)ethylamino]propanamide |
| SMILES | NC(=O)NCCNCC(N)C(N)=O |
| InChI | InChI=1S/C6H15N5O2/c7-4(5(8)12)3-10-1-2-11-6(9)13/h4,10H,1-3,7H2,(H2,8,12)(H3,9,11,13) |
| InChIKey | XFTSHPIFYFHDGS-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|