C5H12N2O4 — CID 112673854
2-(2,3-dihydroxypropylamino)oxyacetamide (PubChem CID 112673854) has the molecular formula C5H12N2O4 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)oxyacetamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)oxyacetamide |
|---|---|
| PubChem CID | 112673854 |
| Molecular Formula | C5H12N2O4 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)oxyacetamide |
| SMILES | NC(=O)CONCC(O)CO |
| InChI | InChI=1S/C5H12N2O4/c6-5(10)3-11-7-1-4(9)2-8/h4,7-9H,1-3H2,(H2,6,10) |
| InChIKey | RRHHRFDPMXXBPX-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|