C8H18N2O3 — CID 91040731
2,3-dihydroxy-4-(2-methylpropylamino)butanamide (PubChem CID 91040731) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(2-methylpropylamino)butanamide.
| Compound Name | 2,3-dihydroxy-4-(2-methylpropylamino)butanamide |
|---|---|
| PubChem CID | 91040731 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2,3-dihydroxy-4-(2-methylpropylamino)butanamide |
| SMILES | CC(C)CNCC(O)C(O)C(N)=O |
| InChI | InChI=1S/C8H18N2O3/c1-5(2)3-10-4-6(11)7(12)8(9)13/h5-7,10-12H,3-4H2,1-2H3,(H2,9,13) |
| InChIKey | QBOCIZGMQMKHAU-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |