About dimethylphosphane;2-hydroxypropanamide
dimethylphosphane;2-hydroxypropanamide (PubChem CID 174842276) has the molecular formula C5H14NO2P
and a molecular weight of 151.15 g/mol. Its IUPAC name is dimethylphosphane;2-hydroxypropanamide.
Molecular Properties
| Compound Name | dimethylphosphane;2-hydroxypropanamide |
| PubChem CID | 174842276 |
| Molecular Formula | C5H14NO2P |
| Molecular Weight | 151.15 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | dimethylphosphane;2-hydroxypropanamide |
| SMILES | CC(O)C(N)=O.CPC |
| InChI | InChI=1S/C3H7NO2.C2H7P/c1-2(5)3(4)6;1-3-2/h2,5H,1H3,(H2,4,6);3H,1-2H3 |
| InChIKey | YJJZRIMVJCOVAQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphane;2-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphane;2-hydroxypropanamide?
The IUPAC name of dimethylphosphane;2-hydroxypropanamide (CID 174842276) is dimethylphosphane;2-hydroxypropanamide.
What is the SMILES notation for dimethylphosphane;2-hydroxypropanamide?
The canonical SMILES for dimethylphosphane;2-hydroxypropanamide is CC(O)C(N)=O.CPC.
What is the InChIKey of dimethylphosphane;2-hydroxypropanamide?
The InChIKey is YJJZRIMVJCOVAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C2H7P/c1-2(5)3(4)6;1-3-2/h2,5H,1H3,(H2,4,6);3H,1-2H3.
What are the key properties of dimethylphosphane;2-hydroxypropanamide?
dimethylphosphane;2-hydroxypropanamide has a molecular weight of 151.15 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphane;2-hydroxypropanamide is sourced from PubChem (CID 174842276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).