About sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate
sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate (PubChem CID 175814248) has the molecular formula C9H21N2NaS2
and a molecular weight of 244.40 g/mol. Its IUPAC name is sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate.
Molecular Properties
| Compound Name | sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate |
| PubChem CID | 175814248 |
| Molecular Formula | C9H21N2NaS2 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate |
| SMILES | CC(C)CNCC(C)C.NC(=S)[S-].[Na+] |
| InChI | InChI=1S/C8H19N.CH3NS2.Na/c1-7(2)5-9-6-8(3)4;2-1(3)4;/h7-9H,5-6H2,1-4H3;(H3,2,3,4);/q;;+1/p-1 |
| InChIKey | WVIYDVRRCUVMEH-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate?
The IUPAC name of sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate (CID 175814248) is sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate.
What is the SMILES notation for sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate?
The canonical SMILES for sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate is CC(C)CNCC(C)C.NC(=S)[S-].[Na+].
What is the InChIKey of sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate?
The InChIKey is WVIYDVRRCUVMEH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19N.CH3NS2.Na/c1-7(2)5-9-6-8(3)4;2-1(3)4;/h7-9H,5-6H2,1-4H3;(H3,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate?
sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate has a molecular weight of 244.40 g/mol, XLogP of -1.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methyl-N-(2-methylpropyl)propan-1-amine;carbamodithioate is sourced from PubChem (CID 175814248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).