C14H29NOS2 — CID 114235084
N-propan-2-yl-2-[2-propyl-2-(sulfanylmethyl)pentyl]sulfanylacetamide (PubChem CID 114235084) has the molecular formula C14H29NOS2 and a molecular weight of 291.53 g/mol. Its IUPAC name is N-propan-2-yl-2-[2-propyl-2-(sulfanylmethyl)pentyl]sulfanylacetamide.
| Compound Name | N-propan-2-yl-2-[2-propyl-2-(sulfanylmethyl)pentyl]sulfanylacetamide |
|---|---|
| PubChem CID | 114235084 |
| Molecular Formula | C14H29NOS2 |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-propan-2-yl-2-[2-propyl-2-(sulfanylmethyl)pentyl]sulfanylacetamide |
| SMILES | CCCC(CS)(CCC)CSCC(=O)NC(C)C |
| InChI | InChI=1S/C14H29NOS2/c1-5-7-14(10-17,8-6-2)11-18-9-13(16)15-12(3)4/h12,17H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | PCAVJZAVTRUGJX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|