C16H33NO2 — CID 178168451
4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide (PubChem CID 178168451) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide.
| Compound Name | 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 178168451 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide |
| SMILES | CCCC(C)(C)COCC(C)(C)CC(=O)NC(C)C |
| InChI | InChI=1S/C16H33NO2/c1-8-9-15(4,5)11-19-12-16(6,7)10-14(18)17-13(2)3/h13H,8-12H2,1-7H3,(H,17,18) |
| InChIKey | AWDYIFFOQSUDID-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |