About 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide
4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide (PubChem CID 178168451) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide |
| PubChem CID | 178168451 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide |
| SMILES | CCCC(C)(C)COCC(C)(C)CC(=O)NC(C)C |
| InChI | InChI=1S/C16H33NO2/c1-8-9-15(4,5)11-19-12-16(6,7)10-14(18)17-13(2)3/h13H,8-12H2,1-7H3,(H,17,18) |
| InChIKey | AWDYIFFOQSUDID-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
The IUPAC name of 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide (CID 178168451) is 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide.
What is the SMILES notation for 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
The canonical SMILES for 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide is CCCC(C)(C)COCC(C)(C)CC(=O)NC(C)C.
What is the InChIKey of 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
The InChIKey is AWDYIFFOQSUDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2/c1-8-9-15(4,5)11-19-12-16(6,7)10-14(18)17-13(2)3/h13H,8-12H2,1-7H3,(H,17,18).
What are the key properties of 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide has a molecular weight of 271.44 g/mol, XLogP of 3.77, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpentoxy)-3,3-dimethyl-N-propan-2-ylbutanamide is sourced from PubChem (CID 178168451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).