C15H32N2OS — CID 107755381
2-methyl-6-pentylsulfanyl-2-(propan-2-ylamino)hexanamide (PubChem CID 107755381) has the molecular formula C15H32N2OS and a molecular weight of 288.50 g/mol. Its IUPAC name is 2-methyl-6-pentylsulfanyl-2-(propan-2-ylamino)hexanamide.
| Compound Name | 2-methyl-6-pentylsulfanyl-2-(propan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 107755381 |
| Molecular Formula | C15H32N2OS |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-methyl-6-pentylsulfanyl-2-(propan-2-ylamino)hexanamide |
| SMILES | CCCCCSCCCCC(C)(NC(C)C)C(N)=O |
| InChI | InChI=1S/C15H32N2OS/c1-5-6-8-11-19-12-9-7-10-15(4,14(16)18)17-13(2)3/h13,17H,5-12H2,1-4H3,(H2,16,18) |
| InChIKey | BCHJQUUIMBYQNL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|