C14H26O2 — CID 87629470
2,5,5-trimethylundecane-3,6-dione (PubChem CID 87629470) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,5,5-trimethylundecane-3,6-dione.
| Compound Name | 2,5,5-trimethylundecane-3,6-dione |
|---|---|
| PubChem CID | 87629470 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,5,5-trimethylundecane-3,6-dione |
| SMILES | CCCCCC(=O)C(C)(C)CC(=O)C(C)C |
| InChI | InChI=1S/C14H26O2/c1-6-7-8-9-13(16)14(4,5)10-12(15)11(2)3/h11H,6-10H2,1-5H3 |
| InChIKey | LZMSIPWYMPMBLV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|