C10H20O3 — CID 129353686
(2S,3R)-2,3-dihydroxy-3-methylnonan-4-one (PubChem CID 129353686) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxy-3-methylnonan-4-one.
| Compound Name | (2S,3R)-2,3-dihydroxy-3-methylnonan-4-one |
|---|---|
| PubChem CID | 129353686 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2S,3R)-2,3-dihydroxy-3-methylnonan-4-one |
| SMILES | CCCCCC(=O)[C@](C)(O)[C@H](C)O |
| InChI | InChI=1S/C10H20O3/c1-4-5-6-7-9(12)10(3,13)8(2)11/h8,11,13H,4-7H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | AWHQXFMMPWRJJE-WCBMZHEXSA-N |
| XLogP | 1.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|