C17H35NO6 — CID 144672826
1-amino-2,3,4,5,6-pentahydroxy-6-methylhexadecan-7-one (PubChem CID 144672826) has the molecular formula C17H35NO6 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-amino-2,3,4,5,6-pentahydroxy-6-methylhexadecan-7-one.
| Compound Name | 1-amino-2,3,4,5,6-pentahydroxy-6-methylhexadecan-7-one |
|---|---|
| PubChem CID | 144672826 |
| Molecular Formula | C17H35NO6 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-amino-2,3,4,5,6-pentahydroxy-6-methylhexadecan-7-one |
| SMILES | CCCCCCCCCC(=O)C(C)(O)C(O)C(O)C(O)C(O)CN |
| InChI | InChI=1S/C17H35NO6/c1-3-4-5-6-7-8-9-10-13(20)17(2,24)16(23)15(22)14(21)12(19)11-18/h12,14-16,19,21-24H,3-11,18H2,1-2H3 |
| InChIKey | NJGIPKZVMMSMPO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|