C20H38O4 — CID 22241836
bis(2,2-dimethylpropyl) 2,3-di(propan-2-yl)butanedioate (PubChem CID 22241836) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2,3-di(propan-2-yl)butanedioate.
| Compound Name | bis(2,2-dimethylpropyl) 2,3-di(propan-2-yl)butanedioate |
|---|---|
| PubChem CID | 22241836 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2,3-di(propan-2-yl)butanedioate |
| SMILES | CC(C)C(C(=O)OCC(C)(C)C)C(C(=O)OCC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H38O4/c1-13(2)15(17(21)23-11-19(5,6)7)16(14(3)4)18(22)24-12-20(8,9)10/h13-16H,11-12H2,1-10H3 |
| InChIKey | HJCDVOQEOGWEHT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |