C16H29BrO4 — CID 23073657
bis(2,2-dimethylpropyl) 2-bromo-2-propan-2-ylpropanedioate (PubChem CID 23073657) has the molecular formula C16H29BrO4 and a molecular weight of 365.31 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-bromo-2-propan-2-ylpropanedioate.
| Compound Name | bis(2,2-dimethylpropyl) 2-bromo-2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 23073657 |
| Molecular Formula | C16H29BrO4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-bromo-2-propan-2-ylpropanedioate |
| SMILES | CC(C)C(Br)(C(=O)OCC(C)(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C16H29BrO4/c1-11(2)16(17,12(18)20-9-14(3,4)5)13(19)21-10-15(6,7)8/h11H,9-10H2,1-8H3 |
| InChIKey | RTERFBRQDTZALT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|