C18H34O4 — CID 22241875
bis(2,2-dimethylpropyl) 2-butan-2-ylbutanedioate (PubChem CID 22241875) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-butan-2-ylbutanedioate.
| Compound Name | bis(2,2-dimethylpropyl) 2-butan-2-ylbutanedioate |
|---|---|
| PubChem CID | 22241875 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-butan-2-ylbutanedioate |
| SMILES | CCC(C)C(CC(=O)OCC(C)(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C18H34O4/c1-9-13(2)14(16(20)22-12-18(6,7)8)10-15(19)21-11-17(3,4)5/h13-14H,9-12H2,1-8H3 |
| InChIKey | IJMIYHHICCXFMT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |