About bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate
bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate (PubChem CID 22241845) has the molecular formula C24H46O4
and a molecular weight of 398.63 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate.
Molecular Properties
| Compound Name | bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate |
| PubChem CID | 22241845 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate |
| SMILES | CC(C)CCC(C(=O)OCC(C)(C)C)C(CCC(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C24H46O4/c1-17(2)11-13-19(21(25)27-15-23(5,6)7)20(14-12-18(3)4)22(26)28-16-24(8,9)10/h17-20H,11-16H2,1-10H3 |
| InChIKey | YEXQXPUBFDSHBM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate?
The IUPAC name of bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate (CID 22241845) is bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate.
What is the SMILES notation for bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate?
The canonical SMILES for bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate is CC(C)CCC(C(=O)OCC(C)(C)C)C(CCC(C)C)C(=O)OCC(C)(C)C.
What is the InChIKey of bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate?
The InChIKey is YEXQXPUBFDSHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O4/c1-17(2)11-13-19(21(25)27-15-23(5,6)7)20(14-12-18(3)4)22(26)28-16-24(8,9)10/h17-20H,11-16H2,1-10H3.
What are the key properties of bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate?
bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate has a molecular weight of 398.63 g/mol, XLogP of 6.27, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropyl) 2,3-bis(3-methylbutyl)butanedioate is sourced from PubChem (CID 22241845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).