C13H24O6 — CID 174423450
2,2-dimethylpropyl 2-acetyl-3-oxobutanoate;ethane-1,2-diol (PubChem CID 174423450) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-acetyl-3-oxobutanoate;ethane-1,2-diol.
| Compound Name | 2,2-dimethylpropyl 2-acetyl-3-oxobutanoate;ethane-1,2-diol |
|---|---|
| PubChem CID | 174423450 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2,2-dimethylpropyl 2-acetyl-3-oxobutanoate;ethane-1,2-diol |
| SMILES | CC(=O)C(C(C)=O)C(=O)OCC(C)(C)C.OCCO |
| InChI | InChI=1S/C11H18O4.C2H6O2/c1-7(12)9(8(2)13)10(14)15-6-11(3,4)5;3-1-2-4/h9H,6H2,1-5H3;3-4H,1-2H2 |
| InChIKey | NLMMXLFQYGTAKK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|