C8H17O6P — CID 168729162
[hydroxy(2-methylpropoxy)phosphoryl]oxymethyl propanoate (PubChem CID 168729162) has the molecular formula C8H17O6P and a molecular weight of 240.19 g/mol. Its IUPAC name is [hydroxy(2-methylpropoxy)phosphoryl]oxymethyl propanoate.
| Compound Name | [hydroxy(2-methylpropoxy)phosphoryl]oxymethyl propanoate |
|---|---|
| PubChem CID | 168729162 |
| Molecular Formula | C8H17O6P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | [hydroxy(2-methylpropoxy)phosphoryl]oxymethyl propanoate |
| SMILES | CCC(=O)OCOP(=O)(O)OCC(C)C |
| InChI | InChI=1S/C8H17O6P/c1-4-8(9)12-6-14-15(10,11)13-5-7(2)3/h7H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | HAQZZDHOVWFQFQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|