C11H21O8PS — CID 59266682
[(2R)-3-[hydroxy(2-sulfanylethoxy)phosphoryl]oxy-2-propanoyloxypropyl] propanoate (PubChem CID 59266682) has the molecular formula C11H21O8PS and a molecular weight of 344.32 g/mol. Its IUPAC name is [(2R)-3-[hydroxy(2-sulfanylethoxy)phosphoryl]oxy-2-propanoyloxypropyl] propanoate.
| Compound Name | [(2R)-3-[hydroxy(2-sulfanylethoxy)phosphoryl]oxy-2-propanoyloxypropyl] propanoate |
|---|---|
| PubChem CID | 59266682 |
| Molecular Formula | C11H21O8PS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [(2R)-3-[hydroxy(2-sulfanylethoxy)phosphoryl]oxy-2-propanoyloxypropyl] propanoate |
| SMILES | CCC(=O)OC[C@H](COP(=O)(O)OCCS)OC(=O)CC |
| InChI | InChI=1S/C11H21O8PS/c1-3-10(12)16-7-9(19-11(13)4-2)8-18-20(14,15)17-5-6-21/h9,21H,3-8H2,1-2H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | LTBGOHZSGUGCPR-SECBINFHSA-N |
| XLogP | 1.32 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|