C30H61NO8PS2+ — CID 22841545
2-[[(2R)-2,3-bis(11-sulfanylundecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 22841545) has the molecular formula C30H61NO8PS2+ and a molecular weight of 658.93 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis(11-sulfanylundecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis(11-sulfanylundecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 22841545 |
| Molecular Formula | C30H61NO8PS2+ |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | 2-[[(2R)-2,3-bis(11-sulfanylundecanoyloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OC[C@@H](COC(=O)CCCCCCCCCCS)OC(=O)CCCCCCCCCCS |
| InChI | InChI=1S/C30H60NO8PS2/c1-31(2,3)22-23-37-40(34,35)38-27-28(39-30(33)21-17-13-9-5-7-11-15-19-25-42)26-36-29(32)20-16-12-8-4-6-10-14-18-24-41/h28H,4-27H2,1-3H3,(H2-,34,35,41,42)/p+1/t28-/m1/s1 |
| InChIKey | JDGAVOYKBALVDU-MUUNZHRXSA-O |
| XLogP | 7.16 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|