C18H40O14P2 — CID 165033493
tert-butyl 2-[2-[2-[2-[2-[2-[hydroxy(2-hydroxyethoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate (PubChem CID 165033493) has the molecular formula C18H40O14P2 and a molecular weight of 542.45 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[2-[2-[hydroxy(2-hydroxyethoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate.
| Compound Name | tert-butyl 2-[2-[2-[2-[2-[2-[hydroxy(2-hydroxyethoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 165033493 |
| Molecular Formula | C18H40O14P2 |
| Molecular Weight | 542.45 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[2-[2-[hydroxy(2-hydroxyethoxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate |
| SMILES | CC(C)(C)OP(=O)(O)OCCOCCOCCOCCOCCOCCOP(=O)(O)OCCO |
| InChI | InChI=1S/C18H40O14P2/c1-18(2,3)32-34(22,23)31-17-15-28-13-11-26-9-7-24-6-8-25-10-12-27-14-16-30-33(20,21)29-5-4-19/h19H,4-17H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | WWLNPVPHQGOSLK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|