C12H25O6P — CID 164813557
tert-butyl 2-[(E)-3,3-dimethylbut-1-enyl]peroxyethyl hydrogen phosphate (PubChem CID 164813557) has the molecular formula C12H25O6P and a molecular weight of 296.30 g/mol. Its IUPAC name is tert-butyl 2-[(E)-3,3-dimethylbut-1-enyl]peroxyethyl hydrogen phosphate.
| Compound Name | tert-butyl 2-[(E)-3,3-dimethylbut-1-enyl]peroxyethyl hydrogen phosphate |
|---|---|
| PubChem CID | 164813557 |
| Molecular Formula | C12H25O6P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | tert-butyl 2-[(E)-3,3-dimethylbut-1-enyl]peroxyethyl hydrogen phosphate |
| SMILES | CC(C)(C)/C=C/OOCCOP(=O)(O)OC(C)(C)C |
| InChI | InChI=1S/C12H25O6P/c1-11(2,3)7-8-15-16-9-10-17-19(13,14)18-12(4,5)6/h7-8H,9-10H2,1-6H3,(H,13,14)/b8-7+ |
| InChIKey | UYWKMSBZYRADOA-BQYQJAHWSA-N |
| XLogP | 3.43 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|