C9H23O12P3 — CID 157111782
tert-butyl 2-[hydroxy-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]phosphoryl]oxyethyl hydrogen phosphate (PubChem CID 157111782) has the molecular formula C9H23O12P3 and a molecular weight of 416.19 g/mol. Its IUPAC name is tert-butyl 2-[hydroxy-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]phosphoryl]oxyethyl hydrogen phosphate.
| Compound Name | tert-butyl 2-[hydroxy-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]phosphoryl]oxyethyl hydrogen phosphate |
|---|---|
| PubChem CID | 157111782 |
| Molecular Formula | C9H23O12P3 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | tert-butyl 2-[hydroxy-[2-[hydroxy(methoxy)phosphoryl]oxyethoxy]phosphoryl]oxyethyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCCOP(=O)(O)OCCOP(=O)(O)OC(C)(C)C |
| InChI | InChI=1S/C9H23O12P3/c1-9(2,3)21-24(14,15)20-8-7-19-23(12,13)18-6-5-17-22(10,11)16-4/h5-8H2,1-4H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | GYQKFKMHSMPGRK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|