C10H22ClO5P — CID 137471459
2-[2-[chloro-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropoxy]ethanol (PubChem CID 137471459) has the molecular formula C10H22ClO5P and a molecular weight of 288.71 g/mol. Its IUPAC name is 2-[2-[chloro-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropoxy]ethanol.
| Compound Name | 2-[2-[chloro-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropoxy]ethanol |
|---|---|
| PubChem CID | 137471459 |
| Molecular Formula | C10H22ClO5P |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[2-[chloro-[(2-methylpropan-2-yl)oxy]phosphoryl]oxy-2-methylpropoxy]ethanol |
| SMILES | CC(C)(C)OP(=O)(Cl)OC(C)(C)COCCO |
| InChI | InChI=1S/C10H22ClO5P/c1-9(2,3)15-17(11,13)16-10(4,5)8-14-7-6-12/h12H,6-8H2,1-5H3 |
| InChIKey | ZNFDWACXBMNXSK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|