C14H30NO6P — CID 168835460
bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-methyl-2-(methylamino)propanoate (PubChem CID 168835460) has the molecular formula C14H30NO6P and a molecular weight of 339.37 g/mol. Its IUPAC name is bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-methyl-2-(methylamino)propanoate.
| Compound Name | bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-methyl-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 168835460 |
| Molecular Formula | C14H30NO6P |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-methyl-2-(methylamino)propanoate |
| SMILES | CNC(C)(C)C(=O)OCOP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C14H30NO6P/c1-12(2,3)20-22(17,21-13(4,5)6)19-10-18-11(16)14(7,8)15-9/h15H,10H2,1-9H3 |
| InChIKey | YCICLSJLDWOUHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|