C9H19O4P-2 — CID 58871450
2,6-dimethylheptan-2-yl phosphate (PubChem CID 58871450) has the molecular formula C9H19O4P-2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 2,6-dimethylheptan-2-yl phosphate.
| Compound Name | 2,6-dimethylheptan-2-yl phosphate |
|---|---|
| PubChem CID | 58871450 |
| Molecular Formula | C9H19O4P-2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2,6-dimethylheptan-2-yl phosphate |
| SMILES | CC(C)CCCC(C)(C)OP(=O)([O-])[O-] |
| InChI | InChI=1S/C9H21O4P/c1-8(2)6-5-7-9(3,4)13-14(10,11)12/h8H,5-7H2,1-4H3,(H2,10,11,12)/p-2 |
| InChIKey | NVNYPMCHHKYRKF-UHFFFAOYSA-L |
| XLogP | 1.44 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|