C15H30NO5P — CID 23431444
(2,12-dimethyl-5,9-dioxotridecan-2-yl)oxyphosphonamidic acid (PubChem CID 23431444) has the molecular formula C15H30NO5P and a molecular weight of 335.38 g/mol. Its IUPAC name is (2,12-dimethyl-5,9-dioxotridecan-2-yl)oxyphosphonamidic acid.
| Compound Name | (2,12-dimethyl-5,9-dioxotridecan-2-yl)oxyphosphonamidic acid |
|---|---|
| PubChem CID | 23431444 |
| Molecular Formula | C15H30NO5P |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (2,12-dimethyl-5,9-dioxotridecan-2-yl)oxyphosphonamidic acid |
| SMILES | CC(C)CCC(=O)CCCC(=O)CCC(C)(C)OP(N)(=O)O |
| InChI | InChI=1S/C15H30NO5P/c1-12(2)8-9-13(17)6-5-7-14(18)10-11-15(3,4)21-22(16,19)20/h12H,5-11H2,1-4H3,(H3,16,19,20) |
| InChIKey | XRKFPSWLARZXGL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|