About disodium;2-methylhexan-2-yl phosphate
disodium;2-methylhexan-2-yl phosphate (PubChem CID 172708640) has the molecular formula C7H15Na2O4P
and a molecular weight of 240.15 g/mol. Its IUPAC name is disodium;2-methylhexan-2-yl phosphate.
Molecular Properties
| Compound Name | disodium;2-methylhexan-2-yl phosphate |
| PubChem CID | 172708640 |
| Molecular Formula | C7H15Na2O4P |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | disodium;2-methylhexan-2-yl phosphate |
| SMILES | CCCCC(C)(C)OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H17O4P.2Na/c1-4-5-6-7(2,3)11-12(8,9)10;;/h4-6H2,1-3H3,(H2,8,9,10);;/q;2*+1/p-2 |
| InChIKey | DYCOUMPGYZQRSE-UHFFFAOYSA-L |
| XLogP | -5.19 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-methylhexan-2-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-methylhexan-2-yl phosphate?
The IUPAC name of disodium;2-methylhexan-2-yl phosphate (CID 172708640) is disodium;2-methylhexan-2-yl phosphate.
What is the SMILES notation for disodium;2-methylhexan-2-yl phosphate?
The canonical SMILES for disodium;2-methylhexan-2-yl phosphate is CCCCC(C)(C)OP(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-methylhexan-2-yl phosphate?
The InChIKey is DYCOUMPGYZQRSE-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H17O4P.2Na/c1-4-5-6-7(2,3)11-12(8,9)10;;/h4-6H2,1-3H3,(H2,8,9,10);;/q;2*+1/p-2.
What are the key properties of disodium;2-methylhexan-2-yl phosphate?
disodium;2-methylhexan-2-yl phosphate has a molecular weight of 240.15 g/mol, XLogP of -5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-methylhexan-2-yl phosphate is sourced from PubChem (CID 172708640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).