C17H37NO2 — CID 156868941
2-[4-(2,6-dimethylheptan-2-yloxy)-2-methylbutan-2-yl]oxy-N-methylethanamine (PubChem CID 156868941) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is 2-[4-(2,6-dimethylheptan-2-yloxy)-2-methylbutan-2-yl]oxy-N-methylethanamine.
| Compound Name | 2-[4-(2,6-dimethylheptan-2-yloxy)-2-methylbutan-2-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 156868941 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | 2-[4-(2,6-dimethylheptan-2-yloxy)-2-methylbutan-2-yl]oxy-N-methylethanamine |
| SMILES | CNCCOC(C)(C)CCOC(C)(C)CCCC(C)C |
| InChI | InChI=1S/C17H37NO2/c1-15(2)9-8-10-16(3,4)19-13-11-17(5,6)20-14-12-18-7/h15,18H,8-14H2,1-7H3 |
| InChIKey | WLFAPCIUZHQDOC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|