C14H32N2O — CID 144922056
N,2,2-trimethyl-4-[2-methyl-5-(methylamino)pentan-2-yl]oxybutan-1-amine (PubChem CID 144922056) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is N,2,2-trimethyl-4-[2-methyl-5-(methylamino)pentan-2-yl]oxybutan-1-amine.
| Compound Name | N,2,2-trimethyl-4-[2-methyl-5-(methylamino)pentan-2-yl]oxybutan-1-amine |
|---|---|
| PubChem CID | 144922056 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | N,2,2-trimethyl-4-[2-methyl-5-(methylamino)pentan-2-yl]oxybutan-1-amine |
| SMILES | CNCCCC(C)(C)OCCC(C)(C)CNC |
| InChI | InChI=1S/C14H32N2O/c1-13(2,12-16-6)9-11-17-14(3,4)8-7-10-15-5/h15-16H,7-12H2,1-6H3 |
| InChIKey | BSMVQNWVEHIQFZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|